C20H26Cl2N2O2 — CID 172897450
4-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methyl]-6-ethylchromen-2-one;dihydrochloride (PubChem CID 172897450) has the molecular formula C20H26Cl2N2O2 and a molecular weight of 397.35 g/mol. Its IUPAC name is 4-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methyl]-6-ethylchromen-2-one;dihydrochloride.
| Compound Name | 4-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methyl]-6-ethylchromen-2-one;dihydrochloride |
|---|---|
| PubChem CID | 172897450 |
| Molecular Formula | C20H26Cl2N2O2 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[[(1R,2S,6R,7S)-4,10-diazatricyclo[5.2.1.02,6]decan-4-yl]methyl]-6-ethylchromen-2-one;dihydrochloride |
| SMILES | CCc1ccc2oc(=O)cc(CN3C[C@@H]4[C@H](C3)[C@@H]3CC[C@H]4N3)c2c1.Cl.Cl |
| InChI | InChI=1S/C20H24N2O2.2ClH/c1-2-12-3-6-19-14(7-12)13(8-20(23)24-19)9-22-10-15-16(11-22)18-5-4-17(15)21-18;;/h3,6-8,15-18,21H,2,4-5,9-11H2,1H3;2*1H/t15-,16+,17-,18+;; |
| InChIKey | COWCWPWFUNBLQH-OHZAAYRNSA-N |
| XLogP | 3.38 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|