C21H30Cl2N2O3 — CID 172897300
6-ethyl-4-[(4-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl)methyl]chromen-2-one;dihydrochloride (PubChem CID 172897300) has the molecular formula C21H30Cl2N2O3 and a molecular weight of 429.39 g/mol. Its IUPAC name is 6-ethyl-4-[(4-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl)methyl]chromen-2-one;dihydrochloride.
| Compound Name | 6-ethyl-4-[(4-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl)methyl]chromen-2-one;dihydrochloride |
|---|---|
| PubChem CID | 172897300 |
| Molecular Formula | C21H30Cl2N2O3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 6-ethyl-4-[(4-hydroxy-2,9-diazaspiro[5.5]undecan-2-yl)methyl]chromen-2-one;dihydrochloride |
| SMILES | CCc1ccc2oc(=O)cc(CN3CC(O)CC4(CCNCC4)C3)c2c1.Cl.Cl |
| InChI | InChI=1S/C21H28N2O3.2ClH/c1-2-15-3-4-19-18(9-15)16(10-20(25)26-19)12-23-13-17(24)11-21(14-23)5-7-22-8-6-21;;/h3-4,9-10,17,22,24H,2,5-8,11-14H2,1H3;2*1H |
| InChIKey | CQWRNFYEJFVECP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|