C25H26F3N3O3 — CID 17251306
2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 17251306) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is 2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17251306 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCc1ccc2oc(=O)cc(CN3CCN(CC(=O)Nc4ccccc4C(F)(F)F)CC3)c2c1 |
| InChI | InChI=1S/C25H26F3N3O3/c1-2-17-7-8-22-19(13-17)18(14-24(33)34-22)15-30-9-11-31(12-10-30)16-23(32)29-21-6-4-3-5-20(21)25(26,27)28/h3-8,13-14H,2,9-12,15-16H2,1H3,(H,29,32) |
| InChIKey | NKRIBYLRLCOTFJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|