C20H21BrF3N3O — CID 30963766
2-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 30963766) has the molecular formula C20H21BrF3N3O and a molecular weight of 456.31 g/mol. Its IUPAC name is 2-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 30963766 |
| Molecular Formula | C20H21BrF3N3O |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Br)cc2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H21BrF3N3O/c21-16-7-5-15(6-8-16)13-26-9-11-27(12-10-26)14-19(28)25-18-4-2-1-3-17(18)20(22,23)24/h1-8H,9-14H2,(H,25,28) |
| InChIKey | JMIGNRROPOXIAQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |