C22H23ClF3N5O3 — CID 30993776
2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 30993776) has the molecular formula C22H23ClF3N5O3 and a molecular weight of 497.91 g/mol. Its IUPAC name is 2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 30993776 |
| Molecular Formula | C22H23ClF3N5O3 |
| Molecular Weight | 497.91 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(CC(=O)Nc2ccccc2C(F)(F)F)CC1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H23ClF3N5O3/c23-17-7-3-1-5-15(17)21(34)29-28-20(33)14-31-11-9-30(10-12-31)13-19(32)27-18-8-4-2-6-16(18)22(24,25)26/h1-8H,9-14H2,(H,27,32)(H,28,33)(H,29,34) |
| InChIKey | ZKLIXZHAOUTBKN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.91 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|