C18H24ClN5O3 — CID 55411004
2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-cyclopropylacetamide (PubChem CID 55411004) has the molecular formula C18H24ClN5O3 and a molecular weight of 393.88 g/mol. Its IUPAC name is 2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 55411004 |
| Molecular Formula | C18H24ClN5O3 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[4-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]piperazin-1-yl]-N-cyclopropylacetamide |
| SMILES | O=C(CN1CCN(CC(=O)NC2CC2)CC1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H24ClN5O3/c19-15-4-2-1-3-14(15)18(27)22-21-17(26)12-24-9-7-23(8-10-24)11-16(25)20-13-5-6-13/h1-4,13H,5-12H2,(H,20,25)(H,21,26)(H,22,27) |
| InChIKey | JOMUMHYBOZUJTM-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|