C21H24ClN5O3 — CID 55816268
1-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55816268) has the molecular formula C21H24ClN5O3 and a molecular weight of 429.91 g/mol. Its IUPAC name is 1-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55816268 |
| Molecular Formula | C21H24ClN5O3 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 1-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-N-(4-methyl-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | Cc1ccnc(NC(=O)C2CCN(CC(=O)NNC(=O)c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C21H24ClN5O3/c1-14-6-9-23-18(12-14)24-20(29)15-7-10-27(11-8-15)13-19(28)25-26-21(30)16-4-2-3-5-17(16)22/h2-6,9,12,15H,7-8,10-11,13H2,1H3,(H,25,28)(H,26,30)(H,23,24,29) |
| InChIKey | IENQAFZQNHVTQZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|