C17H18Cl2N4O4S2 — CID 26607166
2-chloro-N'-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide (PubChem CID 26607166) has the molecular formula C17H18Cl2N4O4S2 and a molecular weight of 477.40 g/mol. Its IUPAC name is 2-chloro-N'-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 26607166 |
| Molecular Formula | C17H18Cl2N4O4S2 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 2-chloro-N'-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]benzohydrazide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H18Cl2N4O4S2/c18-13-4-2-1-3-12(13)17(25)21-20-15(24)11-22-7-9-23(10-8-22)29(26,27)16-6-5-14(19)28-16/h1-6H,7-11H2,(H,20,24)(H,21,25) |
| InChIKey | OJGIYBNIQGWYGC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|