C16H17Cl2N3O3S2 — CID 31378805
N-(4-chlorophenyl)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 31378805) has the molecular formula C16H17Cl2N3O3S2 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 31378805 |
| Molecular Formula | C16H17Cl2N3O3S2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | N-(4-chlorophenyl)-2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2N3O3S2/c17-12-1-3-13(4-2-12)19-15(22)11-20-7-9-21(10-8-20)26(23,24)16-6-5-14(18)25-16/h1-6H,7-11H2,(H,19,22) |
| InChIKey | FVVPGFVUYMYNHK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |