C17H19Cl2N3O3S2 — CID 60501808
N-(4-chlorophenyl)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 60501808) has the molecular formula C17H19Cl2N3O3S2 and a molecular weight of 448.40 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | N-(4-chlorophenyl)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 60501808 |
| Molecular Formula | C17H19Cl2N3O3S2 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-(4-chlorophenyl)-3-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | O=C(CCN1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19Cl2N3O3S2/c18-13-1-3-14(4-2-13)20-16(23)7-8-21-9-11-22(12-10-21)27(24,25)17-6-5-15(19)26-17/h1-6H,7-12H2,(H,20,23) |
| InChIKey | VZKTWMVLKQCSAN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |