C12H16ClN3O5S2 — CID 9304423
methyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]carbamate (PubChem CID 9304423) has the molecular formula C12H16ClN3O5S2 and a molecular weight of 381.86 g/mol. Its IUPAC name is methyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]carbamate.
| Compound Name | methyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 9304423 |
| Molecular Formula | C12H16ClN3O5S2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | methyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]acetyl]carbamate |
| SMILES | COC(=O)NC(=O)CN1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H16ClN3O5S2/c1-21-12(18)14-10(17)8-15-4-6-16(7-5-15)23(19,20)11-3-2-9(13)22-11/h2-3H,4-8H2,1H3,(H,14,17,18) |
| InChIKey | YVIRSRARTKKTSJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |