C13H19ClN3O5S2+ — CID 9304373
ethyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate (PubChem CID 9304373) has the molecular formula C13H19ClN3O5S2+ and a molecular weight of 396.90 g/mol. Its IUPAC name is ethyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 9304373 |
| Molecular Formula | C13H19ClN3O5S2+ |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | ethyl N-[2-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H18ClN3O5S2/c1-2-22-13(19)15-11(18)9-16-5-7-17(8-6-16)24(20,21)12-4-3-10(14)23-12/h3-4H,2,5-9H2,1H3,(H,15,18,19)/p+1 |
| InChIKey | KTBRUGNVENQOKW-UHFFFAOYSA-O |
| XLogP | -0.44 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |