C17H20ClN2O4S2+ — CID 9304431
methyl 4-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]methyl]benzoate (PubChem CID 9304431) has the molecular formula C17H20ClN2O4S2+ and a molecular weight of 415.94 g/mol. Its IUPAC name is methyl 4-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 9304431 |
| Molecular Formula | C17H20ClN2O4S2+ |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | methyl 4-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[NH+]2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)cc1 |
| InChI | InChI=1S/C17H19ClN2O4S2/c1-24-17(21)14-4-2-13(3-5-14)12-19-8-10-20(11-9-19)26(22,23)16-7-6-15(18)25-16/h2-7H,8-12H2,1H3/p+1 |
| InChIKey | LEKFFZMUTHQQNG-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |