C11H14ClNO4S3 — CID 99982681
methyl 2-[(3S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]sulfanylacetate (PubChem CID 99982681) has the molecular formula C11H14ClNO4S3 and a molecular weight of 355.89 g/mol. Its IUPAC name is methyl 2-[(3S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]sulfanylacetate.
| Compound Name | methyl 2-[(3S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 99982681 |
| Molecular Formula | C11H14ClNO4S3 |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | methyl 2-[(3S)-1-(5-chlorothiophen-2-yl)sulfonylpyrrolidin-3-yl]sulfanylacetate |
| SMILES | COC(=O)CS[C@H]1CCN(S(=O)(=O)c2ccc(Cl)s2)C1 |
| InChI | InChI=1S/C11H14ClNO4S3/c1-17-10(14)7-18-8-4-5-13(6-8)20(15,16)11-3-2-9(12)19-11/h2-3,8H,4-7H2,1H3/t8-/m0/s1 |
| InChIKey | UZWILWMOZVBIJY-QMMMGPOBSA-N |
| XLogP | 2.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |