C17H20ClNO3S3 — CID 71800978
1-(5-chlorothiophen-2-yl)sulfonyl-4-[(4-methoxyphenyl)sulfanylmethyl]piperidine (PubChem CID 71800978) has the molecular formula C17H20ClNO3S3 and a molecular weight of 418.01 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-4-[(4-methoxyphenyl)sulfanylmethyl]piperidine.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-[(4-methoxyphenyl)sulfanylmethyl]piperidine |
|---|---|
| PubChem CID | 71800978 |
| Molecular Formula | C17H20ClNO3S3 |
| Molecular Weight | 418.01 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-4-[(4-methoxyphenyl)sulfanylmethyl]piperidine |
| SMILES | COc1ccc(SCC2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)cc1 |
| InChI | InChI=1S/C17H20ClNO3S3/c1-22-14-2-4-15(5-3-14)23-12-13-8-10-19(11-9-13)25(20,21)17-7-6-16(18)24-17/h2-7,13H,8-12H2,1H3 |
| InChIKey | VHTDYUPDXQNCQR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |