C17H19ClN2O4S3 — CID 35041590
1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-methoxyphenyl)sulfanylethanone (PubChem CID 35041590) has the molecular formula C17H19ClN2O4S3 and a molecular weight of 447.00 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-methoxyphenyl)sulfanylethanone.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-methoxyphenyl)sulfanylethanone |
|---|---|
| PubChem CID | 35041590 |
| Molecular Formula | C17H19ClN2O4S3 |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-methoxyphenyl)sulfanylethanone |
| SMILES | COc1cccc(SCC(=O)N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)c1 |
| InChI | InChI=1S/C17H19ClN2O4S3/c1-24-13-3-2-4-14(11-13)25-12-16(21)19-7-9-20(10-8-19)27(22,23)17-6-5-15(18)26-17/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | IOHHBEXDXSSJHC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |