C16H16ClN3O6S2 — CID 35702782
1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-nitrophenoxy)ethanone (PubChem CID 35702782) has the molecular formula C16H16ClN3O6S2 and a molecular weight of 445.91 g/mol. Its IUPAC name is 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-nitrophenoxy)ethanone.
| Compound Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 35702782 |
| Molecular Formula | C16H16ClN3O6S2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-2-(3-nitrophenoxy)ethanone |
| SMILES | O=C(COc1cccc([N+](=O)[O-])c1)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H16ClN3O6S2/c17-14-4-5-16(27-14)28(24,25)19-8-6-18(7-9-19)15(21)11-26-13-3-1-2-12(10-13)20(22)23/h1-5,10H,6-9,11H2 |
| InChIKey | ZPJYHETVVXCYAU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|