C11H21NO4S2 — CID 99873589
methyl 2-[(3S)-1-(2-methylpropylsulfonyl)pyrrolidin-3-yl]sulfanylacetate (PubChem CID 99873589) has the molecular formula C11H21NO4S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is methyl 2-[(3S)-1-(2-methylpropylsulfonyl)pyrrolidin-3-yl]sulfanylacetate.
| Compound Name | methyl 2-[(3S)-1-(2-methylpropylsulfonyl)pyrrolidin-3-yl]sulfanylacetate |
|---|---|
| PubChem CID | 99873589 |
| Molecular Formula | C11H21NO4S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl 2-[(3S)-1-(2-methylpropylsulfonyl)pyrrolidin-3-yl]sulfanylacetate |
| SMILES | COC(=O)CS[C@H]1CCN(S(=O)(=O)CC(C)C)C1 |
| InChI | InChI=1S/C11H21NO4S2/c1-9(2)8-18(14,15)12-5-4-10(6-12)17-7-11(13)16-3/h9-10H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | MINPDIAYCGKMOU-JTQLQIEISA-N |
| XLogP | 0.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |