C18H17ClF3N3O3 — CID 32753939
2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 32753939) has the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.80 g/mol. Its IUPAC name is 2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 32753939 |
| Molecular Formula | C18H17ClF3N3O3 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-[4-(5-chlorofuran-2-carbonyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccc(Cl)o2)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H17ClF3N3O3/c19-15-6-5-14(28-15)17(27)25-9-7-24(8-10-25)11-16(26)23-13-4-2-1-3-12(13)18(20,21)22/h1-6H,7-11H2,(H,23,26) |
| InChIKey | BPAPETIAODPNAM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |