C23H30F3N3O — CID 22193948
2-[4-(2-adamantyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 22193948) has the molecular formula C23H30F3N3O and a molecular weight of 421.51 g/mol. Its IUPAC name is 2-[4-(2-adamantyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(2-adamantyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 22193948 |
| Molecular Formula | C23H30F3N3O |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-[4-(2-adamantyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCN(C2C3CC4CC(C3)CC2C4)CC1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H30F3N3O/c24-23(25,26)19-3-1-2-4-20(19)27-21(30)14-28-5-7-29(8-6-28)22-17-10-15-9-16(12-17)13-18(22)11-15/h1-4,15-18,22H,5-14H2,(H,27,30) |
| InChIKey | ZSYWDDXIHZQPER-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |