C21H29ClN4O — CID 17276225
2-[4-(2-adamantyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 17276225) has the molecular formula C21H29ClN4O and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-[4-(2-adamantyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[4-(2-adamantyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 17276225 |
| Molecular Formula | C21H29ClN4O |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-[4-(2-adamantyl)piperazin-1-yl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | O=C(CN1CCN(C2C3CC4CC(C3)CC2C4)CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C21H29ClN4O/c22-21-18(2-1-3-23-21)24-19(27)13-25-4-6-26(7-5-25)20-16-9-14-8-15(11-16)12-17(20)10-14/h1-3,14-17,20H,4-13H2,(H,24,27) |
| InChIKey | RHYCGTKYSARXIV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|