C16H18Cl2N4OS — CID 8710481
N-(2-chloro-3-pyridinyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 8710481) has the molecular formula C16H18Cl2N4OS and a molecular weight of 385.32 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8710481 |
| Molecular Formula | C16H18Cl2N4OS |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Cl)s2)CC1)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H18Cl2N4OS/c17-14-4-3-12(24-14)10-21-6-8-22(9-7-21)11-15(23)20-13-2-1-5-19-16(13)18/h1-5H,6-11H2,(H,20,23) |
| InChIKey | LREALVFLJROCTH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|