C20H24ClN3O3S — CID 9262168
ethyl 2-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]benzoate (PubChem CID 9262168) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9262168 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | ethyl 2-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C20H24ClN3O3S/c1-2-27-20(26)16-5-3-4-6-17(16)22-19(25)14-24-11-9-23(10-12-24)13-15-7-8-18(21)28-15/h3-8H,2,9-14H2,1H3,(H,22,25) |
| InChIKey | LYHOGUOQUBLUAA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |