C20H25ClN4O2S — CID 8617691
3-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]-N-ethylbenzamide (PubChem CID 8617691) has the molecular formula C20H25ClN4O2S and a molecular weight of 420.97 g/mol. Its IUPAC name is 3-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 8617691 |
| Molecular Formula | C20H25ClN4O2S |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-[[2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN2CCN(Cc3ccc(Cl)s3)CC2)c1 |
| InChI | InChI=1S/C20H25ClN4O2S/c1-2-22-20(27)15-4-3-5-16(12-15)23-19(26)14-25-10-8-24(9-11-25)13-17-6-7-18(21)28-17/h3-7,12H,2,8-11,13-14H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | QWGVNUWRMLERAY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |