C17H25N3O3 — CID 47010706
3-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-ethylbenzamide (PubChem CID 47010706) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 47010706 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 3-[[2-(2,6-dimethylmorpholin-4-yl)acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-4-18-17(22)14-6-5-7-15(8-14)19-16(21)11-20-9-12(2)23-13(3)10-20/h5-8,12-13H,4,9-11H2,1-3H3,(H,18,22)(H,19,21) |
| InChIKey | BTGTXGQBTHFHEW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |