C18H25N3O2 — CID 166256523
3-[[2-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]acetyl]amino]-N-ethylbenzamide (PubChem CID 166256523) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[[2-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 166256523 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-[[2-[(3aS,6aS)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrol-1-yl]acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CN2CC[C@@H]3CCC[C@@H]32)c1 |
| InChI | InChI=1S/C18H25N3O2/c1-2-19-18(23)14-6-3-7-15(11-14)20-17(22)12-21-10-9-13-5-4-8-16(13)21/h3,6-7,11,13,16H,2,4-5,8-10,12H2,1H3,(H,19,23)(H,20,22)/t13-,16-/m0/s1 |
| InChIKey | MFXSKQAYMBOLOM-BBRMVZONSA-N |
| XLogP | 2.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |