C22H29Cl2N3O — CID 22193926
2-[4-(2-adamantyl)piperazin-1-yl]-N-(2,3-dichlorophenyl)acetamide (PubChem CID 22193926) has the molecular formula C22H29Cl2N3O and a molecular weight of 422.40 g/mol. Its IUPAC name is 2-[4-(2-adamantyl)piperazin-1-yl]-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(2-adamantyl)piperazin-1-yl]-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 22193926 |
| Molecular Formula | C22H29Cl2N3O |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[4-(2-adamantyl)piperazin-1-yl]-N-(2,3-dichlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(C2C3CC4CC(C3)CC2C4)CC1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H29Cl2N3O/c23-18-2-1-3-19(21(18)24)25-20(28)13-26-4-6-27(7-5-26)22-16-9-14-8-15(11-16)12-17(22)10-14/h1-3,14-17,22H,4-13H2,(H,25,28) |
| InChIKey | UANOXOXWNMYADK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |