C22H30ClN3O — CID 17349385
2-[4-(1-adamantyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide (PubChem CID 17349385) has the molecular formula C22H30ClN3O and a molecular weight of 387.96 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[4-(1-adamantyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 17349385 |
| Molecular Formula | C22H30ClN3O |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[4-(1-adamantyl)piperazin-1-yl]-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(CN1CCN(C23CC4CC(CC(C4)C2)C3)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C22H30ClN3O/c23-19-3-1-2-4-20(19)24-21(27)15-25-5-7-26(8-6-25)22-12-16-9-17(13-22)11-18(10-16)14-22/h1-4,16-18H,5-15H2,(H,24,27) |
| InChIKey | YYZAHAKPZUGBSW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |