C18H19Cl2N3O2 — CID 2654826
N-(2,3-dichlorophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetamide (PubChem CID 2654826) has the molecular formula C18H19Cl2N3O2 and a molecular weight of 380.28 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 2654826 |
| Molecular Formula | C18H19Cl2N3O2 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccccc2O)CC1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H19Cl2N3O2/c19-13-4-3-5-14(18(13)20)21-17(25)12-22-8-10-23(11-9-22)15-6-1-2-7-16(15)24/h1-7,24H,8-12H2,(H,21,25) |
| InChIKey | RVVAERUCECIRQM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |