C24H33N3O3 — CID 92878461
6-ethyl-4-[[4-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]methyl]chromen-2-one (PubChem CID 92878461) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is 6-ethyl-4-[[4-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 6-ethyl-4-[[4-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 92878461 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | 6-ethyl-4-[[4-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]piperazin-1-yl]methyl]chromen-2-one |
| SMILES | CCc1ccc2oc(=O)cc(CN3CCN(CC(=O)N4CCCC[C@@H]4C)CC3)c2c1 |
| InChI | InChI=1S/C24H33N3O3/c1-3-19-7-8-22-21(14-19)20(15-24(29)30-22)16-25-10-12-26(13-11-25)17-23(28)27-9-5-4-6-18(27)2/h7-8,14-15,18H,3-6,9-13,16-17H2,1-2H3/t18-/m0/s1 |
| InChIKey | ARKLZVJEMCSHBO-SFHVURJKSA-N |
| XLogP | 2.87 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|