C26H31N3O3 — CID 46367769
2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 46367769) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46367769 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[4-[(6-ethyl-2-oxochromen-4-yl)methyl]piperazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | CCc1ccc2oc(=O)cc(CN3CCN(CC(=O)NCc4ccc(C)cc4)CC3)c2c1 |
| InChI | InChI=1S/C26H31N3O3/c1-3-20-8-9-24-23(14-20)22(15-26(31)32-24)17-28-10-12-29(13-11-28)18-25(30)27-16-21-6-4-19(2)5-7-21/h4-9,14-15H,3,10-13,16-18H2,1-2H3,(H,27,30) |
| InChIKey | ZYYIWZAZJYWXRC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|