C23H31N3O4 — CID 17251268
N-cyclopentyl-2-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazin-1-yl]acetamide (PubChem CID 17251268) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17251268 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-cyclopentyl-2-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazin-1-yl]acetamide |
| SMILES | CCOc1ccc2oc(=O)cc(CN3CCN(CC(=O)NC4CCCC4)CC3)c2c1 |
| InChI | InChI=1S/C23H31N3O4/c1-2-29-19-7-8-21-20(14-19)17(13-23(28)30-21)15-25-9-11-26(12-10-25)16-22(27)24-18-5-3-4-6-18/h7-8,13-14,18H,2-6,9-12,15-16H2,1H3,(H,24,27) |
| InChIKey | BYDHVAGYYBKKKU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|