C27H35N3O5 — CID 23608172
1-cyclohexyl-4-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 23608172) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is 1-cyclohexyl-4-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-cyclohexyl-4-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 23608172 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 1-cyclohexyl-4-[4-[(6-ethoxy-2-oxochromen-4-yl)methyl]piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CCOc1ccc2oc(=O)cc(CN3CCN(C(=O)C4CC(=O)N(C5CCCCC5)C4)CC3)c2c1 |
| InChI | InChI=1S/C27H35N3O5/c1-2-34-22-8-9-24-23(16-22)19(15-26(32)35-24)17-28-10-12-29(13-11-28)27(33)20-14-25(31)30(18-20)21-6-4-3-5-7-21/h8-9,15-16,20-21H,2-7,10-14,17-18H2,1H3 |
| InChIKey | ABNTUNNXERUKQT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|