C22H22ClFN2O4S — CID 55351153
6-chloro-7-ethyl-4-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one (PubChem CID 55351153) has the molecular formula C22H22ClFN2O4S and a molecular weight of 464.95 g/mol. Its IUPAC name is 6-chloro-7-ethyl-4-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 6-chloro-7-ethyl-4-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 55351153 |
| Molecular Formula | C22H22ClFN2O4S |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 6-chloro-7-ethyl-4-[[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]methyl]chromen-2-one |
| SMILES | CCc1cc2oc(=O)cc(CN3CCN(S(=O)(=O)c4ccccc4F)CC3)c2cc1Cl |
| InChI | InChI=1S/C22H22ClFN2O4S/c1-2-15-11-20-17(13-18(15)23)16(12-22(27)30-20)14-25-7-9-26(10-8-25)31(28,29)21-6-4-3-5-19(21)24/h3-6,11-13H,2,7-10,14H2,1H3 |
| InChIKey | WUODCNYSOONBIU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|