C24H28N2O4S — CID 55351314
4-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-ethylchromen-2-one (PubChem CID 55351314) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-ethylchromen-2-one.
| Compound Name | 4-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-ethylchromen-2-one |
|---|---|
| PubChem CID | 55351314 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-ethylchromen-2-one |
| SMILES | CCc1ccc2c(CN3CCN(S(=O)(=O)c4ccc(C)cc4C)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H28N2O4S/c1-4-19-6-7-21-20(15-24(27)30-22(21)14-19)16-25-9-11-26(12-10-25)31(28,29)23-8-5-17(2)13-18(23)3/h5-8,13-15H,4,9-12,16H2,1-3H3 |
| InChIKey | PHHRTKTWNHVMOY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|