C23H26N2O5S — CID 2690477
4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-methoxychromen-2-one (PubChem CID 2690477) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 2690477 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CN3CCN(S(=O)(=O)c4cc(C)ccc4C)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C23H26N2O5S/c1-16-4-5-17(2)22(12-16)31(27,28)25-10-8-24(9-11-25)15-18-13-23(26)30-21-14-19(29-3)6-7-20(18)21/h4-7,12-14H,8-11,15H2,1-3H3 |
| InChIKey | CRMXIORBHBNNDB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|