C21H26N6O3S — CID 30858585
1-(2,5-dimethylphenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 30858585) has the molecular formula C21H26N6O3S and a molecular weight of 442.55 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 30858585 |
| Molecular Formula | C21H26N6O3S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | COc1ccc(-n2nnnc2CN2CCN(S(=O)(=O)c3cc(C)ccc3C)CC2)cc1 |
| InChI | InChI=1S/C21H26N6O3S/c1-16-4-5-17(2)20(14-16)31(28,29)26-12-10-25(11-13-26)15-21-22-23-24-27(21)18-6-8-19(30-3)9-7-18/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | IDMOZXGFIYIFEI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|