C19H21ClN6O3S — CID 30858578
1-(4-chlorophenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 30858578) has the molecular formula C19H21ClN6O3S and a molecular weight of 448.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 30858578 |
| Molecular Formula | C19H21ClN6O3S |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-[[1-(4-methoxyphenyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | COc1ccc(-n2nnnc2CN2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H21ClN6O3S/c1-29-17-6-4-16(5-7-17)26-19(21-22-23-26)14-24-10-12-25(13-11-24)30(27,28)18-8-2-15(20)3-9-18/h2-9H,10-14H2,1H3 |
| InChIKey | VDRVPEMTKGGORA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'tetrazole_A(1)', 'substructure': 'N/A'} |
|---|