C19H21BrN6O2S — CID 29339841
1-(4-bromophenyl)sulfonyl-4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 29339841) has the molecular formula C19H21BrN6O2S and a molecular weight of 477.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 29339841 |
| Molecular Formula | C19H21BrN6O2S |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-[[1-(4-methylphenyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | Cc1ccc(-n2nnnc2CN2CCN(S(=O)(=O)c3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H21BrN6O2S/c1-15-2-6-17(7-3-15)26-19(21-22-23-26)14-24-10-12-25(13-11-24)29(27,28)18-8-4-16(20)5-9-18/h2-9H,10-14H2,1H3 |
| InChIKey | QRGDPASRUYAFJX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |