C20H21NO3 — CID 52689134
7-methoxy-4-[(N,2,5-trimethylanilino)methyl]chromen-2-one (PubChem CID 52689134) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 7-methoxy-4-[(N,2,5-trimethylanilino)methyl]chromen-2-one.
| Compound Name | 7-methoxy-4-[(N,2,5-trimethylanilino)methyl]chromen-2-one |
|---|---|
| PubChem CID | 52689134 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 7-methoxy-4-[(N,2,5-trimethylanilino)methyl]chromen-2-one |
| SMILES | COc1ccc2c(CN(C)c3cc(C)ccc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H21NO3/c1-13-5-6-14(2)18(9-13)21(3)12-15-10-20(22)24-19-11-16(23-4)7-8-17(15)19/h5-11H,12H2,1-4H3 |
| InChIKey | QBVLZZKASYNODN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|