C20H19FN2O4 — CID 9252835
N-(4-fluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methyl-methylamino]acetamide (PubChem CID 9252835) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methyl-methylamino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 9252835 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-(4-fluorophenyl)-2-[(7-methoxy-2-oxochromen-4-yl)methyl-methylamino]acetamide |
| SMILES | COc1ccc2c(CN(C)CC(=O)Nc3ccc(F)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H19FN2O4/c1-23(12-19(24)22-15-5-3-14(21)4-6-15)11-13-9-20(25)27-18-10-16(26-2)7-8-17(13)18/h3-10H,11-12H2,1-2H3,(H,22,24) |
| InChIKey | LGHUDMNFVDAAAX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|