C23H25FN2O4 — CID 75457324
N-tert-butyl-N-[2-(4-fluoroanilino)-2-oxoethyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide (PubChem CID 75457324) has the molecular formula C23H25FN2O4 and a molecular weight of 412.46 g/mol. Its IUPAC name is N-tert-butyl-N-[2-(4-fluoroanilino)-2-oxoethyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide.
| Compound Name | N-tert-butyl-N-[2-(4-fluoroanilino)-2-oxoethyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 75457324 |
| Molecular Formula | C23H25FN2O4 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-tert-butyl-N-[2-(4-fluoroanilino)-2-oxoethyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide |
| SMILES | COc1ccc2c(CC(=O)N(CC(=O)Nc3ccc(F)cc3)C(C)(C)C)coc2c1 |
| InChI | InChI=1S/C23H25FN2O4/c1-23(2,3)26(13-21(27)25-17-7-5-16(24)6-8-17)22(28)11-15-14-30-20-12-18(29-4)9-10-19(15)20/h5-10,12,14H,11,13H2,1-4H3,(H,25,27) |
| InChIKey | IXSSUFBLSYVQSA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |