C18H17NO3S — CID 2665602
2-(6-methoxy-1-benzofuran-3-yl)-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 2665602) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-3-yl)-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(6-methoxy-1-benzofuran-3-yl)-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 2665602 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-3-yl)-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | COc1ccc2c(CC(=O)Nc3cccc(SC)c3)coc2c1 |
| InChI | InChI=1S/C18H17NO3S/c1-21-14-6-7-16-12(11-22-17(16)10-14)8-18(20)19-13-4-3-5-15(9-13)23-2/h3-7,9-11H,8H2,1-2H3,(H,19,20) |
| InChIKey | RTCWLASTUUEUPC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |