C19H18N2O7S — CID 4841640
[2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 4841640) has the molecular formula C19H18N2O7S and a molecular weight of 418.43 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 4841640 |
| Molecular Formula | C19H18N2O7S |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCC(=O)Nc3cccc(S(N)(=O)=O)c3)coc2c1 |
| InChI | InChI=1S/C19H18N2O7S/c1-26-14-5-6-16-12(10-27-17(16)9-14)7-19(23)28-11-18(22)21-13-3-2-4-15(8-13)29(20,24)25/h2-6,8-10H,7,11H2,1H3,(H,21,22)(H2,20,24,25) |
| InChIKey | HZKDJSDGCMVILX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |