C20H16N2O5 — CID 2126246
[2-(2-cyanoanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate (PubChem CID 2126246) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 2126246 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(6-methoxy-1-benzofuran-3-yl)acetate |
| SMILES | COc1ccc2c(CC(=O)OCC(=O)Nc3ccccc3C#N)coc2c1 |
| InChI | InChI=1S/C20H16N2O5/c1-25-15-6-7-16-14(11-26-18(16)9-15)8-20(24)27-12-19(23)22-17-5-3-2-4-13(17)10-21/h2-7,9,11H,8,12H2,1H3,(H,22,23) |
| InChIKey | ZPHPJKHASBAOMB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |