C21H18N2O4 — CID 8525492
[2-(2-cyanoanilino)-2-oxoethyl] 2-(6-ethyl-1-benzofuran-3-yl)acetate (PubChem CID 8525492) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-(6-ethyl-1-benzofuran-3-yl)acetate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(6-ethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8525492 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-(6-ethyl-1-benzofuran-3-yl)acetate |
| SMILES | CCc1ccc2c(CC(=O)OCC(=O)Nc3ccccc3C#N)coc2c1 |
| InChI | InChI=1S/C21H18N2O4/c1-2-14-7-8-17-16(12-26-19(17)9-14)10-21(25)27-13-20(24)23-18-6-4-3-5-15(18)11-22/h3-9,12H,2,10,13H2,1H3,(H,23,24) |
| InChIKey | VAPGZYHKVMVCOH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |