C20H17NO3 — CID 8846086
(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate (PubChem CID 8846086) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate.
| Compound Name | (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 8846086 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate |
| SMILES | CCc1ccc2c(CC(=O)OCc3ccccc3C#N)coc2c1 |
| InChI | InChI=1S/C20H17NO3/c1-2-14-7-8-18-17(13-23-19(18)9-14)10-20(22)24-12-16-6-4-3-5-15(16)11-21/h3-9,13H,2,10,12H2,1H3 |
| InChIKey | OSDRVMFMDNAYNC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |