(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate

C20H17NO3 — CID 8846086

IUPAC(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate
SMILESCCc1ccc2c(CC(=O)OCc3ccccc3C#N)coc2c1
InChIInChI=1S/C20H17NO3/c1-2-14-7-8-18-17(13-23-19(18)9-14)10-20(22)24-12-16-6-4-3-5-15(16)11-21/h3-9,13H,2,10,12H2,1H3
InChIKeyOSDRVMFMDNAYNC-UHFFFAOYSA-N
MW319.36 g/mol
LogP4.15
Rot. Bonds5

About (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate

(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate (PubChem CID 8846086) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate.

Molecular Properties

Compound Name(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate
PubChem CID8846086
Molecular FormulaC20H17NO3
Molecular Weight319.36 g/mol
Exact Mass319.12
IUPAC Name(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate
SMILESCCc1ccc2c(CC(=O)OCc3ccccc3C#N)coc2c1
InChIInChI=1S/C20H17NO3/c1-2-14-7-8-18-17(13-23-19(18)9-14)10-20(22)24-12-16-6-4-3-5-15(16)11-21/h3-9,13H,2,10,12H2,1H3
InChIKeyOSDRVMFMDNAYNC-UHFFFAOYSA-N
XLogP4.15
TPSA63.23 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.36
LogP ≤ 54.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate?
The IUPAC name of (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate (CID 8846086) is (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate.
What is the SMILES notation for (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate?
The canonical SMILES for (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate is CCc1ccc2c(CC(=O)OCc3ccccc3C#N)coc2c1.
What is the InChIKey of (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate?
The InChIKey is OSDRVMFMDNAYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO3/c1-2-14-7-8-18-17(13-23-19(18)9-14)10-20(22)24-12-16-6-4-3-5-15(16)11-21/h3-9,13H,2,10,12H2,1H3.
What are the key properties of (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate?
(2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate has a molecular weight of 319.36 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyanophenyl)methyl 2-(6-ethyl-1-benzofuran-3-yl)acetate is sourced from PubChem (CID 8846086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).