C23H18O4 — CID 7415600
(4-phenylphenyl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7415600) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is (4-phenylphenyl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | (4-phenylphenyl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7415600 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (4-phenylphenyl)methyl 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | O=C(Cc1coc2cc(O)ccc12)OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18O4/c24-20-10-11-21-19(15-26-22(21)13-20)12-23(25)27-14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-11,13,15,24H,12,14H2 |
| InChIKey | JHPBGVXEVNMTGY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |