C18H15NO5 — CID 7807183
(2-anilino-2-oxoethyl) 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7807183) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7807183 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1coc2cc(O)ccc12)Nc1ccccc1 |
| InChI | InChI=1S/C18H15NO5/c20-14-6-7-15-12(10-23-16(15)9-14)8-18(22)24-11-17(21)19-13-4-2-1-3-5-13/h1-7,9-10,20H,8,11H2,(H,19,21) |
| InChIKey | NUELYSRQTYQMGV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |