C17H15NO5S — CID 7807088
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate (PubChem CID 7807088) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7807088 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-(6-hydroxy-1-benzofuran-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1coc2cc(O)ccc12)NCc1cccs1 |
| InChI | InChI=1S/C17H15NO5S/c19-12-3-4-14-11(9-22-15(14)7-12)6-17(21)23-10-16(20)18-8-13-2-1-5-24-13/h1-5,7,9,19H,6,8,10H2,(H,18,20) |
| InChIKey | UQMHQMNQFLJSCG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |